About 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile
4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 71012723) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 71012723 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | Cc1ccc(C2=CC=C(C#N)CC2)cc1C |
| InChI | InChI=1S/C15H15N/c1-11-3-6-15(9-12(11)2)14-7-4-13(10-16)5-8-14/h3-4,6-7,9H,5,8H2,1-2H3 |
| InChIKey | YABNHJMTPSHDHH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile (CID 71012723) is 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile is Cc1ccc(C2=CC=C(C#N)CC2)cc1C.
What is the InChIKey of 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is YABNHJMTPSHDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-11-3-6-15(9-12(11)2)14-7-4-13(10-16)5-8-14/h3-4,6-7,9H,5,8H2,1-2H3.
What are the key properties of 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile?
4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 209.29 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylphenyl)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 71012723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).