C13H18O6 — CID 71012987
methyl 2-[(3aS,5S,6E,6aS)-4-hydroxy-6-(hydroxymethylidene)-3a,6a-dimethyl-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate (PubChem CID 71012987) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 2-[(3aS,5S,6E,6aS)-4-hydroxy-6-(hydroxymethylidene)-3a,6a-dimethyl-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate.
| Compound Name | methyl 2-[(3aS,5S,6E,6aS)-4-hydroxy-6-(hydroxymethylidene)-3a,6a-dimethyl-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate |
|---|---|
| PubChem CID | 71012987 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 2-[(3aS,5S,6E,6aS)-4-hydroxy-6-(hydroxymethylidene)-3a,6a-dimethyl-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate |
| SMILES | COC(=O)C[C@H]1/C(=C\O)[C@]2(C)COC(=O)[C@]2(C)C1O |
| InChI | InChI=1S/C13H18O6/c1-12-6-19-11(17)13(12,2)10(16)7(8(12)5-14)4-9(15)18-3/h5,7,10,14,16H,4,6H2,1-3H3/b8-5+/t7-,10?,12-,13-/m0/s1 |
| InChIKey | JQMXPBHBLZQDTF-POXNTIGWSA-N |
| XLogP | 0.55 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|