C20H30O5 — CID 71013416
(3E,7E,9S,10R,11S,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-14-[(2R)-3-oxobutan-2-yl]-1-oxacyclotetradeca-3,7,12-trien-2-one (PubChem CID 71013416) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3E,7E,9S,10R,11S,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-14-[(2R)-3-oxobutan-2-yl]-1-oxacyclotetradeca-3,7,12-trien-2-one.
| Compound Name | (3E,7E,9S,10R,11S,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-14-[(2R)-3-oxobutan-2-yl]-1-oxacyclotetradeca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 71013416 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (3E,7E,9S,10R,11S,12Z)-10-hydroxy-9-methoxy-11,13-dimethyl-14-[(2R)-3-oxobutan-2-yl]-1-oxacyclotetradeca-3,7,12-trien-2-one |
| SMILES | CO[C@H]1/C=C/CC/C=C/C(=O)OC([C@@H](C)C(C)=O)/C(C)=C\[C@H](C)[C@H]1O |
| InChI | InChI=1S/C20H30O5/c1-13-12-14(2)20(15(3)16(4)21)25-18(22)11-9-7-6-8-10-17(24-5)19(13)23/h8-13,15,17,19-20,23H,6-7H2,1-5H3/b10-8+,11-9+,14-12-/t13-,15-,17-,19+,20?/m0/s1 |
| InChIKey | FPBSTQWEHLJEMV-GRNKUIMUSA-N |
| XLogP | 2.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|