C8H12O3S2 — CID 71013444
(4R,6S)-6-methyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-4-ol (PubChem CID 71013444) has the molecular formula C8H12O3S2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4R,6S)-6-methyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-4-ol.
| Compound Name | (4R,6S)-6-methyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-4-ol |
|---|---|
| PubChem CID | 71013444 |
| Molecular Formula | C8H12O3S2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | (4R,6S)-6-methyl-7,7-dioxo-3,4,5,6-tetrahydro-2H-thieno[2,3-b]thiopyran-4-ol |
| SMILES | C[C@H]1C[C@@H](O)C2=C(SCC2)S1(=O)=O |
| InChI | InChI=1S/C8H12O3S2/c1-5-4-7(9)6-2-3-12-8(6)13(5,10)11/h5,7,9H,2-4H2,1H3/t5-,7+/m0/s1 |
| InChIKey | OZFWMQYERUSJPI-CAHLUQPWSA-N |
| XLogP | 0.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |