C22H23N7O2 — CID 71014207
(E)-2-cyano-3-[5-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-pyridinyl]-N,N-dimethylprop-2-enamide (PubChem CID 71014207) has the molecular formula C22H23N7O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-pyridinyl]-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-pyridinyl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 71014207 |
| Molecular Formula | C22H23N7O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (E)-2-cyano-3-[5-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]-2-pyridinyl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C/c1ccc(Nc2cnc3[nH]cc(C(=O)C(C)(C)C)c3n2)cn1 |
| InChI | InChI=1S/C22H23N7O2/c1-22(2,3)19(30)16-11-25-20-18(16)28-17(12-26-20)27-15-7-6-14(24-10-15)8-13(9-23)21(31)29(4)5/h6-8,10-12H,1-5H3,(H,25,26)(H,27,28)/b13-8+ |
| InChIKey | OGMLTZUTACBZHC-MDWZMJQESA-N |
| XLogP | 3.32 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|