C19H18N6O — CID 71014428
(E)-2-cyano-N,N-dimethyl-3-[2-methyl-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)phenyl]prop-2-enamide (PubChem CID 71014428) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is (E)-2-cyano-N,N-dimethyl-3-[2-methyl-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N,N-dimethyl-3-[2-methyl-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71014428 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (E)-2-cyano-N,N-dimethyl-3-[2-methyl-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)phenyl]prop-2-enamide |
| SMILES | Cc1c(/C=C(\C#N)C(=O)N(C)C)cccc1Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C19H18N6O/c1-12-13(9-14(10-20)19(26)25(2)3)5-4-6-16(12)24-18-15-7-8-21-17(15)22-11-23-18/h4-9,11H,1-3H3,(H2,21,22,23,24)/b14-9+ |
| InChIKey | FWZYNLAMBYHMCF-NTEUORMPSA-N |
| XLogP | 3.01 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|