C31H30ClFN2OSi — CID 71015364
[1-[14-chloro-5-(1-fluoroethyl)-6,12-diazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12,14-heptaen-2-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane (PubChem CID 71015364) has the molecular formula C31H30ClFN2OSi and a molecular weight of 529.13 g/mol. Its IUPAC name is [1-[14-chloro-5-(1-fluoroethyl)-6,12-diazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12,14-heptaen-2-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane.
| Compound Name | [1-[14-chloro-5-(1-fluoroethyl)-6,12-diazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12,14-heptaen-2-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 71015364 |
| Molecular Formula | C31H30ClFN2OSi |
| Molecular Weight | 529.13 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [1-[14-chloro-5-(1-fluoroethyl)-6,12-diazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,12,14-heptaen-2-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane |
| SMILES | CC(F)c1cc2c(cn1)C=Cc1ncc(Cl)cc1C2CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30ClFN2OSi/c1-21(33)30-17-26-22(19-34-30)14-15-29-27(16-23(32)20-35-29)28(26)18-31(2,3)37(36,24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-17,19-21,28,36H,18H2,1-3H3 |
| InChIKey | DPRHDAHDEPOFIW-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.13 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|