C21H20N6O4S — CID 71015646
4-[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-4,5-dihydropyrazolo[5,1-d][1,5]benzoxazepine-9-carbonyl]thiomorpholine-2,3-dione (PubChem CID 71015646) has the molecular formula C21H20N6O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is 4-[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-4,5-dihydropyrazolo[5,1-d][1,5]benzoxazepine-9-carbonyl]thiomorpholine-2,3-dione.
| Compound Name | 4-[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-4,5-dihydropyrazolo[5,1-d][1,5]benzoxazepine-9-carbonyl]thiomorpholine-2,3-dione |
|---|---|
| PubChem CID | 71015646 |
| Molecular Formula | C21H20N6O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 4-[2-(2-propan-2-yl-1,2,4-triazol-3-yl)-4,5-dihydropyrazolo[5,1-d][1,5]benzoxazepine-9-carbonyl]thiomorpholine-2,3-dione |
| SMILES | CC(C)n1ncnc1-c1cc2n(n1)-c1cc(C(=O)N3CCSC(=O)C3=O)ccc1OCC2 |
| InChI | InChI=1S/C21H20N6O4S/c1-12(2)26-18(22-11-23-26)15-10-14-5-7-31-17-4-3-13(9-16(17)27(14)24-15)19(28)25-6-8-32-21(30)20(25)29/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | SACAXLUXOFNDLW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|