C28H27N5OS — CID 71015722
2-propan-2-yloxy-5-[5-[5-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]benzonitrile (PubChem CID 71015722) has the molecular formula C28H27N5OS and a molecular weight of 481.63 g/mol. Its IUPAC name is 2-propan-2-yloxy-5-[5-[5-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]benzonitrile.
| Compound Name | 2-propan-2-yloxy-5-[5-[5-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 71015722 |
| Molecular Formula | C28H27N5OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 2-propan-2-yloxy-5-[5-[5-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3,4-thiadiazol-2-yl]benzonitrile |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCCC4NCc3cccnc3)s2)cc1C#N |
| InChI | InChI=1S/C28H27N5OS/c1-18(2)34-26-12-11-20(14-21(26)15-29)27-32-33-28(35-27)24-9-3-8-23-22(24)7-4-10-25(23)31-17-19-6-5-13-30-16-19/h3,5-6,8-9,11-14,16,18,25,31H,4,7,10,17H2,1-2H3 |
| InChIKey | YFOYJNBGVJBDCW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |