C29H25F2N7O2 — CID 71015877
2-[(2S)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 71015877) has the molecular formula C29H25F2N7O2 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-[(2S)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | 2-[(2S)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 71015877 |
| Molecular Formula | C29H25F2N7O2 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-[(2S)-2-[[4-amino-3-[2-fluoro-4-(3-fluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | N#CC(=CC1CC1)C(=O)N1CCC[C@H]1Cn1nc(-c2ccc(Oc3cccc(F)c3)cc2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C29H25F2N7O2/c30-19-3-1-5-21(12-19)40-22-8-9-23(24(31)13-22)26-25-27(33)34-16-35-28(25)38(36-26)15-20-4-2-10-37(20)29(39)18(14-32)11-17-6-7-17/h1,3,5,8-9,11-13,16-17,20H,2,4,6-7,10,15H2,(H2,33,34,35)/t20-/m0/s1 |
| InChIKey | UDMBWKPTVSCOHR-FQEVSTJZSA-N |
| XLogP | 5.00 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|