About 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene
6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene (PubChem CID 71015954) has the molecular formula C12H16F2O
and a molecular weight of 214.25 g/mol. Its IUPAC name is 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene |
| PubChem CID | 71015954 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene |
| SMILES | CCC1(C)C=CC2=C(C1)C(F)(F)CCO2 |
| InChI | InChI=1S/C12H16F2O/c1-3-11(2)5-4-10-9(8-11)12(13,14)6-7-15-10/h4-5H,3,6-8H2,1-2H3 |
| InChIKey | DPJMDNWFHRTGIS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene?
The IUPAC name of 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene (CID 71015954) is 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene.
What is the SMILES notation for 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene?
The canonical SMILES for 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene is CCC1(C)C=CC2=C(C1)C(F)(F)CCO2.
What is the InChIKey of 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene?
The InChIKey is DPJMDNWFHRTGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O/c1-3-11(2)5-4-10-9(8-11)12(13,14)6-7-15-10/h4-5H,3,6-8H2,1-2H3.
What are the key properties of 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene?
6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene has a molecular weight of 214.25 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4,4-difluoro-6-methyl-3,5-dihydro-2H-chromene is sourced from PubChem (CID 71015954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).