C33H45NO5 — CID 71016193
2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(1S)-3-(1-naphthalen-1-ylethylamino)cyclohexyl]cyclohexa-1,5-diene-1-carboxylate (PubChem CID 71016193) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(1S)-3-(1-naphthalen-1-ylethylamino)cyclohexyl]cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(1S)-3-(1-naphthalen-1-ylethylamino)cyclohexyl]cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 71016193 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(1S)-3-(1-naphthalen-1-ylethylamino)cyclohexyl]cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCOCCOCCOCCOC(=O)C1=CCC([C@H]2CCCC(NC(C)c3cccc4ccccc34)C2)C=C1 |
| InChI | InChI=1S/C33H45NO5/c1-3-36-18-19-37-20-21-38-22-23-39-33(35)28-16-14-26(15-17-28)29-10-6-11-30(24-29)34-25(2)31-13-7-9-27-8-4-5-12-32(27)31/h4-5,7-9,12-14,16-17,25-26,29-30,34H,3,6,10-11,15,18-24H2,1-2H3/t25?,26?,29-,30?/m0/s1 |
| InChIKey | JXAKTBXMRAOODN-RERUELHHSA-N |
| XLogP | 6.16 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|