C20H32N2 — CID 71016261
(1E,5R)-1-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]-N,N-dipropyl-2,4,5,6-tetrahydroisoindol-5-amine (PubChem CID 71016261) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (1E,5R)-1-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]-N,N-dipropyl-2,4,5,6-tetrahydroisoindol-5-amine.
| Compound Name | (1E,5R)-1-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]-N,N-dipropyl-2,4,5,6-tetrahydroisoindol-5-amine |
|---|---|
| PubChem CID | 71016261 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (1E,5R)-1-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]-N,N-dipropyl-2,4,5,6-tetrahydroisoindol-5-amine |
| SMILES | C/C=C\C1=c2c(c[nH]/c2=C/C)C[C@@H](N(CCC)CCC)C1C |
| InChI | InChI=1S/C20H32N2/c1-6-10-17-15(5)19(22(11-7-2)12-8-3)13-16-14-21-18(9-4)20(16)17/h6,9-10,14-15,19,21H,7-8,11-13H2,1-5H3/b10-6-,18-9+/t15?,19-/m1/s1 |
| InChIKey | GVBOGIGNEWYKDI-UBLMTEQTSA-N |
| XLogP | 3.22 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |