About 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol
4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol (PubChem CID 710164) has the molecular formula C13H8BrCl2NO
and a molecular weight of 345.02 g/mol. Its IUPAC name is 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol |
| PubChem CID | 710164 |
| Molecular Formula | C13H8BrCl2NO |
| Molecular Weight | 345.02 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H8BrCl2NO/c14-9-1-2-13(18)8(3-9)7-17-12-5-10(15)4-11(16)6-12/h1-7,18H/b17-7+ |
| InChIKey | UHGJKERLQDVILY-REZTVBANSA-N |
| XLogP | 5.21 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.02 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol?
The IUPAC name of 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol (CID 710164) is 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol.
What is the SMILES notation for 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol?
The canonical SMILES for 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol is Oc1ccc(Br)cc1/C=N/c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol?
The InChIKey is UHGJKERLQDVILY-REZTVBANSA-N. The full InChI is InChI=1S/C13H8BrCl2NO/c14-9-1-2-13(18)8(3-9)7-17-12-5-10(15)4-11(16)6-12/h1-7,18H/b17-7+.
What are the key properties of 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol?
4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol has a molecular weight of 345.02 g/mol, XLogP of 5.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[(3,5-dichlorophenyl)iminomethyl]phenol is sourced from PubChem (CID 710164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).