C20H24O4 — CID 71016764
(2S,3R,4S,5S,6R)-2-[(2-benzylphenyl)methyl]-6-methyloxane-3,4,5-triol (PubChem CID 71016764) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[(2-benzylphenyl)methyl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[(2-benzylphenyl)methyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 71016764 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2-benzylphenyl)methyl]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1O[C@@H](Cc2ccccc2Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24O4/c1-13-18(21)20(23)19(22)17(24-13)12-16-10-6-5-9-15(16)11-14-7-3-2-4-8-14/h2-10,13,17-23H,11-12H2,1H3/t13-,17+,18-,19+,20+/m1/s1 |
| InChIKey | FNLXCRTZBYXWNK-UQSIQIAASA-N |
| XLogP | 1.69 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |