C19H25ClN2S2 — CID 71017195
5-chloro-2-(4,5-dihydro-1,3-thiazol-2-ylmethylidene)-3-octyl-1,3-benzothiazole (PubChem CID 71017195) has the molecular formula C19H25ClN2S2 and a molecular weight of 381.01 g/mol. Its IUPAC name is 5-chloro-2-(4,5-dihydro-1,3-thiazol-2-ylmethylidene)-3-octyl-1,3-benzothiazole.
| Compound Name | 5-chloro-2-(4,5-dihydro-1,3-thiazol-2-ylmethylidene)-3-octyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 71017195 |
| Molecular Formula | C19H25ClN2S2 |
| Molecular Weight | 381.01 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-chloro-2-(4,5-dihydro-1,3-thiazol-2-ylmethylidene)-3-octyl-1,3-benzothiazole |
| SMILES | CCCCCCCCN1C(=CC2=NCCS2)Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H25ClN2S2/c1-2-3-4-5-6-7-11-22-16-13-15(20)8-9-17(16)24-19(22)14-18-21-10-12-23-18/h8-9,13-14H,2-7,10-12H2,1H3 |
| InChIKey | UGOSGJMASZQSBG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.01 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|