C28H37N3O3 — CID 71017925
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide (PubChem CID 71017925) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 71017925 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-5-methyl-1H-imidazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc(C3(O)[C@H](C)C4CC[C@@H](O4)[C@@H]3C)cc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C28H37N3O3/c1-16-15-29-25(30-16)26(32)31-22-7-6-20(14-21(22)19-10-12-27(4,5)13-11-19)28(33)17(2)23-8-9-24(34-23)18(28)3/h6-7,10,14-15,17-18,23-24,33H,8-9,11-13H2,1-5H3,(H,29,30)(H,31,32)/t17-,18+,23+,24?,28?/m0/s1 |
| InChIKey | XGPHPZFVRVCUID-NXCJAKRKSA-N |
| XLogP | 5.58 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |