C28H34N4O3 — CID 71017935
5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide (PubChem CID 71017935) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 71017935 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-[(2R,4S,5R)-3-hydroxy-2,4-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]phenyl]-1H-imidazole-2-carboxamide |
| SMILES | C[C@@H]1C2CC[C@@H](O2)[C@H](C)C1(O)c1ccc(NC(=O)c2ncc(C#N)[nH]2)c(C2=CCC(C)(C)CC2)c1 |
| InChI | InChI=1S/C28H34N4O3/c1-16-23-7-8-24(35-23)17(2)28(16,34)19-5-6-22(32-26(33)25-30-15-20(14-29)31-25)21(13-19)18-9-11-27(3,4)12-10-18/h5-6,9,13,15-17,23-24,34H,7-8,10-12H2,1-4H3,(H,30,31)(H,32,33)/t16-,17+,23+,24?,28?/m0/s1 |
| InChIKey | ZVYSJHZJAAQVSG-GIFUIUCZSA-N |
| XLogP | 5.15 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |