C26H37N3O — CID 71017966
2-(1-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-phenyl-1-adamantyl)acetamide (PubChem CID 71017966) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 2-(1-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-phenyl-1-adamantyl)acetamide.
| Compound Name | 2-(1-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-phenyl-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 71017966 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 2-(1-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-phenyl-1-adamantyl)acetamide |
| SMILES | CC1C2CCCN2CCN1CC(=O)NC12CC3CC(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C26H37N3O/c1-19-23-8-5-9-28(23)10-11-29(19)17-24(30)27-26-15-20-12-21(16-26)14-25(13-20,18-26)22-6-3-2-4-7-22/h2-4,6-7,19-21,23H,5,8-18H2,1H3,(H,27,30) |
| InChIKey | UBALTDHUYZVZPE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |