About tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate
tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate (PubChem CID 71018069) has the molecular formula C19H29FO2S
and a molecular weight of 340.50 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate |
| PubChem CID | 71018069 |
| Molecular Formula | C19H29FO2S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)OC(=O)CC(CCSc1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C19H29FO2S/c1-18(2,3)14(13-17(21)22-19(4,5)6)11-12-23-16-9-7-15(20)8-10-16/h7-10,14H,11-13H2,1-6H3 |
| InChIKey | INSXDUSYMISHKE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate?
The IUPAC name of tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate (CID 71018069) is tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate.
What is the SMILES notation for tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate?
The canonical SMILES for tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate is CC(C)(C)OC(=O)CC(CCSc1ccc(F)cc1)C(C)(C)C.
What is the InChIKey of tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate?
The InChIKey is INSXDUSYMISHKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29FO2S/c1-18(2,3)14(13-17(21)22-19(4,5)6)11-12-23-16-9-7-15(20)8-10-16/h7-10,14H,11-13H2,1-6H3.
What are the key properties of tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate?
tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate has a molecular weight of 340.50 g/mol, XLogP of 5.70, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-(4-fluorophenyl)sulfanylethyl]-4,4-dimethylpentanoate is sourced from PubChem (CID 71018069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).