C14H20N2 — CID 71018226
3-(cyclohexen-1-yl)-2-methyl-3a,4,5,7a-tetrahydrobenzimidazole (PubChem CID 71018226) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-2-methyl-3a,4,5,7a-tetrahydrobenzimidazole.
| Compound Name | 3-(cyclohexen-1-yl)-2-methyl-3a,4,5,7a-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 71018226 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-(cyclohexen-1-yl)-2-methyl-3a,4,5,7a-tetrahydrobenzimidazole |
| SMILES | CC1=NC2C=CCCC2N1C1=CCCCC1 |
| InChI | InChI=1S/C14H20N2/c1-11-15-13-9-5-6-10-14(13)16(11)12-7-3-2-4-8-12/h5,7,9,13-14H,2-4,6,8,10H2,1H3 |
| InChIKey | OXTVMOMOXZEYIA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|