C15H24N2 — CID 71018229
3-methyl-2-(1-methylcyclohexyl)-3a,4,5,7a-tetrahydrobenzimidazole (PubChem CID 71018229) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-methyl-2-(1-methylcyclohexyl)-3a,4,5,7a-tetrahydrobenzimidazole.
| Compound Name | 3-methyl-2-(1-methylcyclohexyl)-3a,4,5,7a-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 71018229 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-methyl-2-(1-methylcyclohexyl)-3a,4,5,7a-tetrahydrobenzimidazole |
| SMILES | CN1C(C2(C)CCCCC2)=NC2C=CCCC21 |
| InChI | InChI=1S/C15H24N2/c1-15(10-6-3-7-11-15)14-16-12-8-4-5-9-13(12)17(14)2/h4,8,12-13H,3,5-7,9-11H2,1-2H3 |
| InChIKey | FOOFFBBXVNUGRB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|