C20H20N6O2 — CID 71018529
1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-[(2-hydroxyphenyl)methyl]-2,3-dihydroindole-5-carboxamide (PubChem CID 71018529) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-[(2-hydroxyphenyl)methyl]-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-[(2-hydroxyphenyl)methyl]-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 71018529 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-[(2-hydroxyphenyl)methyl]-2,3-dihydroindole-5-carboxamide |
| SMILES | Cc1nc(N)nc(N2CCc3cc(C(=O)NCc4ccccc4O)ccc32)n1 |
| InChI | InChI=1S/C20H20N6O2/c1-12-23-19(21)25-20(24-12)26-9-8-13-10-14(6-7-16(13)26)18(28)22-11-15-4-2-3-5-17(15)27/h2-7,10,27H,8-9,11H2,1H3,(H,22,28)(H2,21,23,24,25) |
| InChIKey | ATXFKXRYBVMXRO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|