About methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate
methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate (PubChem CID 71018815) has the molecular formula C26H25NO2
and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate |
| PubChem CID | 71018815 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate |
| SMILES | COC(=O)c1ccc([C@]2(c3ccc(-c4ccccn4)cc3)CC3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C26H25NO2/c1-29-25(28)20-8-13-22(14-9-20)26(17-18-5-10-23(26)16-18)21-11-6-19(7-12-21)24-4-2-3-15-27-24/h2-4,6-9,11-15,18,23H,5,10,16-17H2,1H3/t18?,23-,26-/m1/s1 |
| InChIKey | QQGXZIPHYWQILP-TWGVZLPFSA-N |
| XLogP | 5.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate?
The IUPAC name of methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate (CID 71018815) is methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate.
What is the SMILES notation for methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate?
The canonical SMILES for methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate is COC(=O)c1ccc([C@]2(c3ccc(-c4ccccn4)cc3)CC3CC[C@@H]2C3)cc1.
What is the InChIKey of methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate?
The InChIKey is QQGXZIPHYWQILP-TWGVZLPFSA-N. The full InChI is InChI=1S/C26H25NO2/c1-29-25(28)20-8-13-22(14-9-20)26(17-18-5-10-23(26)16-18)21-11-6-19(7-12-21)24-4-2-3-15-27-24/h2-4,6-9,11-15,18,23H,5,10,16-17H2,1H3/t18?,23-,26-/m1/s1.
What are the key properties of methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate?
methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate has a molecular weight of 383.49 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1R,2R)-2-(4-pyridin-2-ylphenyl)-2-bicyclo[2.2.1]heptanyl]benzoate is sourced from PubChem (CID 71018815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).