C8H10Cl3N3OS — CID 71018973
2-[2-sulfanylidene-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide (PubChem CID 71018973) has the molecular formula C8H10Cl3N3OS and a molecular weight of 302.61 g/mol. Its IUPAC name is 2-[2-sulfanylidene-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide.
| Compound Name | 2-[2-sulfanylidene-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide |
|---|---|
| PubChem CID | 71018973 |
| Molecular Formula | C8H10Cl3N3OS |
| Molecular Weight | 302.61 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2-[2-sulfanylidene-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide |
| SMILES | CC(C(N)=O)c1cn(CC(Cl)(Cl)Cl)c(=S)[nH]1 |
| InChI | InChI=1S/C8H10Cl3N3OS/c1-4(6(12)15)5-2-14(7(16)13-5)3-8(9,10)11/h2,4H,3H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | VKDIKLOMVWVNFR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|