C10H13N3O3 — CID 71019019
2,4-dioxo-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-9-carboxamide (PubChem CID 71019019) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2,4-dioxo-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-9-carboxamide.
| Compound Name | 2,4-dioxo-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-9-carboxamide |
|---|---|
| PubChem CID | 71019019 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2,4-dioxo-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-9-carboxamide |
| SMILES | NC(=O)C1CCCCc2c1[nH]c(=O)[nH]c2=O |
| InChI | InChI=1S/C10H13N3O3/c11-8(14)5-3-1-2-4-6-7(5)12-10(16)13-9(6)15/h5H,1-4H2,(H2,11,14)(H2,12,13,15,16) |
| InChIKey | ZFSNIJZBADGQRI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |