C9H12Cl3N3O2 — CID 71019088
2-[4-methyl-2-oxo-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide (PubChem CID 71019088) has the molecular formula C9H12Cl3N3O2 and a molecular weight of 300.57 g/mol. Its IUPAC name is 2-[4-methyl-2-oxo-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide.
| Compound Name | 2-[4-methyl-2-oxo-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide |
|---|---|
| PubChem CID | 71019088 |
| Molecular Formula | C9H12Cl3N3O2 |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-[4-methyl-2-oxo-3-(2,2,2-trichloroethyl)-1H-imidazol-5-yl]propanamide |
| SMILES | Cc1c(C(C)C(N)=O)[nH]c(=O)n1CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3N3O2/c1-4(7(13)16)6-5(2)15(8(17)14-6)3-9(10,11)12/h4H,3H2,1-2H3,(H2,13,16)(H,14,17) |
| InChIKey | KWQPGGANLGMBNR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|