About 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide
2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide (PubChem CID 71019097) has the molecular formula C9H12F3N3O2
and a molecular weight of 251.21 g/mol. Its IUPAC name is 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide.
Molecular Properties
| Compound Name | 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide |
| PubChem CID | 71019097 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide |
| SMILES | CC(C(N)=O)c1cn(CCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12F3N3O2/c1-5(7(13)16)6-4-15(8(17)14-6)3-2-9(10,11)12/h4-5H,2-3H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | KBIOVQHBVUEIPS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide?
The IUPAC name of 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide (CID 71019097) is 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide.
What is the SMILES notation for 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide?
The canonical SMILES for 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide is CC(C(N)=O)c1cn(CCC(F)(F)F)c(=O)[nH]1.
What is the InChIKey of 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide?
The InChIKey is KBIOVQHBVUEIPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O2/c1-5(7(13)16)6-4-15(8(17)14-6)3-2-9(10,11)12/h4-5H,2-3H2,1H3,(H2,13,16)(H,14,17).
What are the key properties of 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide?
2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide has a molecular weight of 251.21 g/mol, XLogP of 0.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]propanamide is sourced from PubChem (CID 71019097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).