About 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide
2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide (PubChem CID 71019131) has the molecular formula C8H10FN3O3
and a molecular weight of 215.18 g/mol. Its IUPAC name is 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide.
Molecular Properties
| Compound Name | 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide |
| PubChem CID | 71019131 |
| Molecular Formula | C8H10FN3O3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide |
| SMILES | NC(=O)Cc1cc(=O)n(CCF)c(=O)[nH]1 |
| InChI | InChI=1S/C8H10FN3O3/c9-1-2-12-7(14)4-5(3-6(10)13)11-8(12)15/h4H,1-3H2,(H2,10,13)(H,11,15) |
| InChIKey | KVRGEDHSHYBWDM-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide?
The IUPAC name of 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide (CID 71019131) is 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide.
What is the SMILES notation for 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide?
The canonical SMILES for 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide is NC(=O)Cc1cc(=O)n(CCF)c(=O)[nH]1.
What is the InChIKey of 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide?
The InChIKey is KVRGEDHSHYBWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN3O3/c9-1-2-12-7(14)4-5(3-6(10)13)11-8(12)15/h4H,1-3H2,(H2,10,13)(H,11,15).
What are the key properties of 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide?
2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide has a molecular weight of 215.18 g/mol, XLogP of -1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-fluoroethyl)-2,4-dioxo-1H-pyrimidin-6-yl]acetamide is sourced from PubChem (CID 71019131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).