About 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide
2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide (PubChem CID 71019224) has the molecular formula C8H10F3N3OS
and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide |
| PubChem CID | 71019224 |
| Molecular Formula | C8H10F3N3OS |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide |
| SMILES | NC(=O)Cc1cn(CCC(F)(F)F)c(=S)[nH]1 |
| InChI | InChI=1S/C8H10F3N3OS/c9-8(10,11)1-2-14-4-5(3-6(12)15)13-7(14)16/h4H,1-3H2,(H2,12,15)(H,13,16) |
| InChIKey | KFYISIGNVGPZIH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide?
The IUPAC name of 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide (CID 71019224) is 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide.
What is the SMILES notation for 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide?
The canonical SMILES for 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide is NC(=O)Cc1cn(CCC(F)(F)F)c(=S)[nH]1.
What is the InChIKey of 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide?
The InChIKey is KFYISIGNVGPZIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3OS/c9-8(10,11)1-2-14-4-5(3-6(12)15)13-7(14)16/h4H,1-3H2,(H2,12,15)(H,13,16).
What are the key properties of 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide?
2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide has a molecular weight of 253.25 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-sulfanylidene-3-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]acetamide is sourced from PubChem (CID 71019224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).