C25H28FN5O2 — CID 71019337
2-[3-[4-[3-(4-fluorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-1-bicyclo[2.2.2]octanyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol (PubChem CID 71019337) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[3-[4-[3-(4-fluorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-1-bicyclo[2.2.2]octanyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol.
| Compound Name | 2-[3-[4-[3-(4-fluorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-1-bicyclo[2.2.2]octanyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 71019337 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-[3-[4-[3-(4-fluorophenyl)-2,3-dihydro-1,2,4-oxadiazol-5-yl]-1-bicyclo[2.2.2]octanyl]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cccn2c(C34CCC(C5=NC(c6ccc(F)cc6)NO5)(CC3)CC4)nnc12 |
| InChI | InChI=1S/C25H28FN5O2/c1-23(2,32)18-4-3-15-31-20(18)28-29-21(31)24-9-12-25(13-10-24,14-11-24)22-27-19(30-33-22)16-5-7-17(26)8-6-16/h3-8,15,19,30,32H,9-14H2,1-2H3 |
| InChIKey | FVNYXDFWDDYCFG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |