C26H37N5O4 — CID 71019372
5-amino-N-[6-[(2S,6R)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide (PubChem CID 71019372) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 5-amino-N-[6-[(2S,6R)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-amino-N-[6-[(2S,6R)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 71019372 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 5-amino-N-[6-[(2S,6R)-2,6-bis(hydroxymethyl)-2,6-dimethyloxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3C[C@](C)(CO)O[C@](C)(CO)C3)ccc2NC(=O)c2ncc(N)[nH]2)CC1 |
| InChI | InChI=1S/C26H37N5O4/c1-24(2)9-7-16(8-10-24)21-19(30-23(34)22-28-13-20(27)31-22)6-5-18(29-21)17-11-25(3,14-32)35-26(4,12-17)15-33/h5-7,13,17,32-33H,8-12,14-15,27H2,1-4H3,(H,28,31)(H,30,34)/t17?,25-,26+ |
| InChIKey | JORSZKLPAKLKRM-SOMFESITSA-N |
| XLogP | 3.63 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |