C15H26O3 — CID 71019374
(1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-propan-2-yl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane (PubChem CID 71019374) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-propan-2-yl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane.
| Compound Name | (1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-propan-2-yl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
|---|---|
| PubChem CID | 71019374 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-propan-2-yl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
| SMILES | CC(C)C1C[C@@]2(C)O[C@@](C)(C1)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H26O3/c1-9(2)10-7-14(5)11-12(15(6,8-10)18-14)17-13(3,4)16-11/h9-12H,7-8H2,1-6H3/t10?,11-,12+,14+,15- |
| InChIKey | WRYDQYOFXFPKAY-SRJRYOLQSA-N |
| XLogP | 3.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |