C16H31BO4 — CID 71019441
2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxypropan-1-ol (PubChem CID 71019441) has the molecular formula C16H31BO4 and a molecular weight of 298.23 g/mol. Its IUPAC name is 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxypropan-1-ol.
| Compound Name | 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 71019441 |
| Molecular Formula | C16H31BO4 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxypropan-1-ol |
| SMILES | CC(C)(CO)OC1CCC(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C16H31BO4/c1-14(2,11-18)19-13-9-7-12(8-10-13)17-20-15(3,4)16(5,6)21-17/h12-13,18H,7-11H2,1-6H3 |
| InChIKey | TZNFXEVMYRLOJK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|