C26H35N5O4 — CID 71019459
5-amino-N-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide (PubChem CID 71019459) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is 5-amino-N-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-amino-N-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 71019459 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 5-amino-N-[6-[(1R,5S,6R,7S)-6,7-dihydroxy-1,5-dimethyl-8-oxabicyclo[3.2.1]octan-3-yl]-2-(4,4-dimethylcyclohexen-1-yl)-3-pyridinyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3C[C@@]4(C)O[C@@](C)(C3)[C@H](O)[C@@H]4O)ccc2NC(=O)c2ncc(N)[nH]2)CC1 |
| InChI | InChI=1S/C26H35N5O4/c1-24(2)9-7-14(8-10-24)19-17(30-23(34)22-28-13-18(27)31-22)6-5-16(29-19)15-11-25(3)20(32)21(33)26(4,12-15)35-25/h5-7,13,15,20-21,32-33H,8-12,27H2,1-4H3,(H,28,31)(H,30,34)/t15?,20-,21+,25+,26- |
| InChIKey | LFARWCUFDBZKRZ-LDZFRTPCSA-N |
| XLogP | 3.38 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |