C27H35N5O4 — CID 71019463
5-amino-N-[2-(cyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide (PubChem CID 71019463) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is 5-amino-N-[2-(cyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-amino-N-[2-(cyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 71019463 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 5-amino-N-[2-(cyclohexen-1-yl)-6-[(1R,2S,6R,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@]1(C)CC(c3ccc(NC(=O)c4ncc(N)[nH]4)c(C4=CCCCC4)n3)C[C@]2(C)O1 |
| InChI | InChI=1S/C27H35N5O4/c1-25(2)34-21-22(35-25)27(4)13-16(12-26(21,3)36-27)17-10-11-18(20(30-17)15-8-6-5-7-9-15)31-24(33)23-29-14-19(28)32-23/h8,10-11,14,16,21-22H,5-7,9,12-13,28H2,1-4H3,(H,29,32)(H,31,33)/t16?,21-,22+,26+,27- |
| InChIKey | UROTWPVMCQUKPU-VTRZGGHSSA-N |
| XLogP | 4.54 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |