C15H30N+ — CID 71019553
1-tert-butyl-2,2,4,4-tetramethyl-5-propan-2-yl-3H-pyrrol-1-ium (PubChem CID 71019553) has the molecular formula C15H30N+ and a molecular weight of 224.41 g/mol. Its IUPAC name is 1-tert-butyl-2,2,4,4-tetramethyl-5-propan-2-yl-3H-pyrrol-1-ium.
| Compound Name | 1-tert-butyl-2,2,4,4-tetramethyl-5-propan-2-yl-3H-pyrrol-1-ium |
|---|---|
| PubChem CID | 71019553 |
| Molecular Formula | C15H30N+ |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.24 |
| IUPAC Name | 1-tert-butyl-2,2,4,4-tetramethyl-5-propan-2-yl-3H-pyrrol-1-ium |
| SMILES | CC(C)C1=[N+](C(C)(C)C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C15H30N/c1-11(2)12-14(6,7)10-15(8,9)16(12)13(3,4)5/h11H,10H2,1-9H3/q+1 |
| InChIKey | WNPHEHGDRJMNTA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|