C17H18FN — CID 71019876
11-cycloprop-2-en-1-yl-3-fluoro-6,7,8,9,10,11a-hexahydro-1H-cyclohepta[b]quinoline (PubChem CID 71019876) has the molecular formula C17H18FN and a molecular weight of 255.33 g/mol. Its IUPAC name is 11-cycloprop-2-en-1-yl-3-fluoro-6,7,8,9,10,11a-hexahydro-1H-cyclohepta[b]quinoline.
| Compound Name | 11-cycloprop-2-en-1-yl-3-fluoro-6,7,8,9,10,11a-hexahydro-1H-cyclohepta[b]quinoline |
|---|---|
| PubChem CID | 71019876 |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 11-cycloprop-2-en-1-yl-3-fluoro-6,7,8,9,10,11a-hexahydro-1H-cyclohepta[b]quinoline |
| SMILES | C1CCC2=C(C3CC=C(C=C3N=C2CC1)F)C4C=C4 |
| InChI | InChI=1S/C17H18FN/c18-12-8-9-14-16(10-12)19-15-5-3-1-2-4-13(15)17(14)11-6-7-11/h6-8,10-11,14H,1-5,9H2 |
| InChIKey | FOLNGYDPHDTEKP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | 568 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|