About ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate
ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate (PubChem CID 71020337) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate |
| PubChem CID | 71020337 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2c[nH]c3ncccc23)cc1N |
| InChI | InChI=1S/C14H13N3O2S/c1-2-19-14(18)12-10(15)6-11(20-12)9-7-17-13-8(9)4-3-5-16-13/h3-7H,2,15H2,1H3,(H,16,17) |
| InChIKey | VVTNZYRULHABIV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate?
The IUPAC name of ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate (CID 71020337) is ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate.
What is the SMILES notation for ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate?
The canonical SMILES for ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate is CCOC(=O)c1sc(-c2c[nH]c3ncccc23)cc1N.
What is the InChIKey of ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate?
The InChIKey is VVTNZYRULHABIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-2-19-14(18)12-10(15)6-11(20-12)9-7-17-13-8(9)4-3-5-16-13/h3-7H,2,15H2,1H3,(H,16,17).
What are the key properties of ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate?
ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate has a molecular weight of 287.34 g/mol, XLogP of 3.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophene-2-carboxylate is sourced from PubChem (CID 71020337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).