About methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate
methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate (PubChem CID 71020451) has the molecular formula C27H32ClNO3
and a molecular weight of 454.01 g/mol. Its IUPAC name is methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate |
| PubChem CID | 71020451 |
| Molecular Formula | C27H32ClNO3 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate |
| SMILES | COC(=O)CC(C)(C)CCN1CCC(=C2c3ccc(Cl)cc3COc3ccccc32)CC1 |
| InChI | InChI=1S/C27H32ClNO3/c1-27(2,17-25(30)31-3)12-15-29-13-10-19(11-14-29)26-22-9-8-21(28)16-20(22)18-32-24-7-5-4-6-23(24)26/h4-9,16H,10-15,17-18H2,1-3H3 |
| InChIKey | XTOIUYUMZPOIFT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate?
The IUPAC name of methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate (CID 71020451) is methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate.
What is the SMILES notation for methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate?
The canonical SMILES for methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate is COC(=O)CC(C)(C)CCN1CCC(=C2c3ccc(Cl)cc3COc3ccccc32)CC1.
What is the InChIKey of methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate?
The InChIKey is XTOIUYUMZPOIFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32ClNO3/c1-27(2,17-25(30)31-3)12-15-29-13-10-19(11-14-29)26-22-9-8-21(28)16-20(22)18-32-24-7-5-4-6-23(24)26/h4-9,16H,10-15,17-18H2,1-3H3.
What are the key properties of methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate?
methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate has a molecular weight of 454.01 g/mol, XLogP of 6.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[4-(8-chloro-6H-benzo[c][1]benzoxepin-11-ylidene)piperidin-1-yl]-3,3-dimethylpentanoate is sourced from PubChem (CID 71020451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).