About CID 71020640
CID 71020640 (PubChem CID 71020640) has the molecular formula C29H25Cl2FN4O4
and a molecular weight of 583.45 g/mol.
Molecular Properties
| Compound Name | CID 71020640 |
| PubChem CID | 71020640 |
| Molecular Formula | C29H25Cl2FN4O4 |
| Molecular Weight | 583.45 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc(NC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)cn1 |
| InChI | InChI=1S/C29H25Cl2FN4O4/c30-15-7-9-18-21(13-15)35-27(40)29(18)22(17-5-4-6-19(31)23(17)32)24(36-28(29)11-2-1-3-12-28)25(37)34-16-8-10-20(26(38)39)33-14-16/h4-10,13-14,22,24,36H,1-3,11-12H2,(H,34,37)(H,35,40)(H,38,39)/t22-,24+,29+/m0/s1 |
| InChIKey | YRQMWWJYNFOFFG-IQANXLHVSA-N |
| XLogP | 5.51 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 583.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 71020640 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71020640?
The IUPAC name of CID 71020640 (CID 71020640) is not available.
What is the SMILES notation for CID 71020640?
The canonical SMILES for CID 71020640 is O=C(O)c1ccc(NC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)cn1.
What is the InChIKey of CID 71020640?
The InChIKey is YRQMWWJYNFOFFG-IQANXLHVSA-N. The full InChI is InChI=1S/C29H25Cl2FN4O4/c30-15-7-9-18-21(13-15)35-27(40)29(18)22(17-5-4-6-19(31)23(17)32)24(36-28(29)11-2-1-3-12-28)25(37)34-16-8-10-20(26(38)39)33-14-16/h4-10,13-14,22,24,36H,1-3,11-12H2,(H,34,37)(H,35,40)(H,38,39)/t22-,24+,29+/m0/s1.
What are the key properties of CID 71020640?
CID 71020640 has a molecular weight of 583.45 g/mol, XLogP of 5.51, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71020640 is sourced from PubChem (CID 71020640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).