About CID 71020645
CID 71020645 (PubChem CID 71020645) has the molecular formula C30H25Cl2F2N3O4
and a molecular weight of 600.45 g/mol.
Molecular Properties
| Compound Name | CID 71020645 |
| PubChem CID | 71020645 |
| Molecular Formula | C30H25Cl2F2N3O4 |
| Molecular Weight | 600.45 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc(NC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)c(F)c1 |
| InChI | InChI=1S/C30H25Cl2F2N3O4/c31-16-8-9-18-22(14-16)36-28(41)30(18)23(17-5-4-6-19(32)24(17)34)25(37-29(30)11-2-1-3-12-29)26(38)35-21-10-7-15(27(39)40)13-20(21)33/h4-10,13-14,23,25,37H,1-3,11-12H2,(H,35,38)(H,36,41)(H,39,40)/t23-,25+,30+/m0/s1 |
| InChIKey | LCUYAMKESYPQRA-LOLKONATSA-N |
| XLogP | 6.26 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 71020645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71020645?
The IUPAC name of CID 71020645 (CID 71020645) is not available.
What is the SMILES notation for CID 71020645?
The canonical SMILES for CID 71020645 is O=C(O)c1ccc(NC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)c(F)c1.
What is the InChIKey of CID 71020645?
The InChIKey is LCUYAMKESYPQRA-LOLKONATSA-N. The full InChI is InChI=1S/C30H25Cl2F2N3O4/c31-16-8-9-18-22(14-16)36-28(41)30(18)23(17-5-4-6-19(32)24(17)34)25(37-29(30)11-2-1-3-12-29)26(38)35-21-10-7-15(27(39)40)13-20(21)33/h4-10,13-14,23,25,37H,1-3,11-12H2,(H,35,38)(H,36,41)(H,39,40)/t23-,25+,30+/m0/s1.
What are the key properties of CID 71020645?
CID 71020645 has a molecular weight of 600.45 g/mol, XLogP of 6.26, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71020645 is sourced from PubChem (CID 71020645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).