About N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide
N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide (PubChem CID 71020819) has the molecular formula C26H29N3O2
and a molecular weight of 415.54 g/mol. Its IUPAC name is N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide.
Molecular Properties
| Compound Name | N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide |
| PubChem CID | 71020819 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide |
| SMILES | CCCCN(c1ccc(C#N)c2ccccc12)N(C)C(=O)C(CC)Oc1ccccc1 |
| InChI | InChI=1S/C26H29N3O2/c1-4-6-18-29(24-17-16-20(19-27)22-14-10-11-15-23(22)24)28(3)26(30)25(5-2)31-21-12-8-7-9-13-21/h7-17,25H,4-6,18H2,1-3H3 |
| InChIKey | SXKBATQOFBOKPU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide?
The IUPAC name of N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide (CID 71020819) is N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide.
What is the SMILES notation for N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide?
The canonical SMILES for N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide is CCCCN(c1ccc(C#N)c2ccccc12)N(C)C(=O)C(CC)Oc1ccccc1.
What is the InChIKey of N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide?
The InChIKey is SXKBATQOFBOKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N3O2/c1-4-6-18-29(24-17-16-20(19-27)22-14-10-11-15-23(22)24)28(3)26(30)25(5-2)31-21-12-8-7-9-13-21/h7-17,25H,4-6,18H2,1-3H3.
What are the key properties of N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide?
N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide has a molecular weight of 415.54 g/mol, XLogP of 5.55, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N'-(4-cyanonaphthalen-1-yl)-N-methyl-2-phenoxybutanehydrazide is sourced from PubChem (CID 71020819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).