C14H24O4 — CID 71021200
(1S,2R,6S,7R)-9-ethyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-ol (PubChem CID 71021200) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1S,2R,6S,7R)-9-ethyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-ol.
| Compound Name | (1S,2R,6S,7R)-9-ethyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-ol |
|---|---|
| PubChem CID | 71021200 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (1S,2R,6S,7R)-9-ethyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-ol |
| SMILES | CCC1(O)C[C@@]2(C)O[C@@](C)(C1)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H24O4/c1-6-14(15)7-12(4)9-10(13(5,8-14)18-12)17-11(2,3)16-9/h9-10,15H,6-8H2,1-5H3/t9-,10+,12+,13-,14? |
| InChIKey | ZGRSHPUZTIPHAO-YENVBVIYSA-N |
| XLogP | 1.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |