C33H51N5O3Si — CID 71021206
4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)-4,5-dihydroimidazole-2-carboxamide (PubChem CID 71021206) has the molecular formula C33H51N5O3Si and a molecular weight of 593.89 g/mol. Its IUPAC name is 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)-4,5-dihydroimidazole-2-carboxamide.
| Compound Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)-4,5-dihydroimidazole-2-carboxamide |
|---|---|
| PubChem CID | 71021206 |
| Molecular Formula | C33H51N5O3Si |
| Molecular Weight | 593.89 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)-4,5-dihydroimidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3CC(C)(C)OC(C)(C)C3)ccc2NC(=O)C2=NC(C#N)CN2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C33H51N5O3Si/c1-31(2)14-12-23(13-15-31)28-27(11-10-26(36-28)24-18-32(3,4)41-33(5,6)19-24)37-30(39)29-35-25(20-34)21-38(29)22-40-16-17-42(7,8)9/h10-12,24-25H,13-19,21-22H2,1-9H3,(H,37,39) |
| InChIKey | PBANAYSOADFLEI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.89 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|