C16H28O3 — CID 71021211
(1R,2S,6R,7S)-9-tert-butyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane (PubChem CID 71021211) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (1R,2S,6R,7S)-9-tert-butyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane.
| Compound Name | (1R,2S,6R,7S)-9-tert-butyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
|---|---|
| PubChem CID | 71021211 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (1R,2S,6R,7S)-9-tert-butyl-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@]1(C)CC(C(C)(C)C)C[C@]2(C)O1 |
| InChI | InChI=1S/C16H28O3/c1-13(2,3)10-8-15(6)11-12(16(7,9-10)19-15)18-14(4,5)17-11/h10-12H,8-9H2,1-7H3/t10?,11-,12+,15+,16- |
| InChIKey | XIACDQQPVBIUCX-KIHTWRGISA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |