C14H26O4 — CID 71021322
(1S,5R,6S,7R)-1,5-dimethyl-3-(2-methylbutan-2-yl)-8-oxabicyclo[3.2.1]octane-3,6,7-triol (PubChem CID 71021322) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S,5R,6S,7R)-1,5-dimethyl-3-(2-methylbutan-2-yl)-8-oxabicyclo[3.2.1]octane-3,6,7-triol.
| Compound Name | (1S,5R,6S,7R)-1,5-dimethyl-3-(2-methylbutan-2-yl)-8-oxabicyclo[3.2.1]octane-3,6,7-triol |
|---|---|
| PubChem CID | 71021322 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (1S,5R,6S,7R)-1,5-dimethyl-3-(2-methylbutan-2-yl)-8-oxabicyclo[3.2.1]octane-3,6,7-triol |
| SMILES | CCC(C)(C)C1(O)C[C@@]2(C)O[C@@](C)(C1)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C14H26O4/c1-6-11(2,3)14(17)7-12(4)9(15)10(16)13(5,8-14)18-12/h9-10,15-17H,6-8H2,1-5H3/t9-,10+,12+,13-,14? |
| InChIKey | XWZGUKXUAWVRIE-YENVBVIYSA-N |
| XLogP | 1.22 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |