C17H30O3 — CID 71021323
(1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-(2-methylbutan-2-yl)-3,5,11-trioxatricyclo[5.3.1.02,6]undecane (PubChem CID 71021323) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-(2-methylbutan-2-yl)-3,5,11-trioxatricyclo[5.3.1.02,6]undecane.
| Compound Name | (1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-(2-methylbutan-2-yl)-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
|---|---|
| PubChem CID | 71021323 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (1S,2R,6S,7R)-1,4,4,7-tetramethyl-9-(2-methylbutan-2-yl)-3,5,11-trioxatricyclo[5.3.1.02,6]undecane |
| SMILES | CCC(C)(C)C1C[C@@]2(C)O[C@@](C)(C1)[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H30O3/c1-8-14(2,3)11-9-16(6)12-13(17(7,10-11)20-16)19-15(4,5)18-12/h11-13H,8-10H2,1-7H3/t11?,12-,13+,16+,17- |
| InChIKey | CPLDWUUCQDACAD-KYQOMENCSA-N |
| XLogP | 3.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |