C18H18N5S+ — CID 71021610
2-(3-cyclohexa-1,5-dien-1-yl-5-phenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole (PubChem CID 71021610) has the molecular formula C18H18N5S+ and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-(3-cyclohexa-1,5-dien-1-yl-5-phenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-(3-cyclohexa-1,5-dien-1-yl-5-phenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 71021610 |
| Molecular Formula | C18H18N5S+ |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(3-cyclohexa-1,5-dien-1-yl-5-phenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(-[n+]2nc(-c3ccccc3)nn2C2=CCCC=C2)sc1C |
| InChI | InChI=1S/C18H18N5S/c1-13-14(2)24-18(19-13)23-21-17(15-9-5-3-6-10-15)20-22(23)16-11-7-4-8-12-16/h3,5-7,9-12H,4,8H2,1-2H3/q+1 |
| InChIKey | AGBYWGPWXHMHHE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|