About (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide
(3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 7102181) has the molecular formula C5H11NO4S2
and a molecular weight of 213.28 g/mol. Its IUPAC name is (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 7102181 |
| Molecular Formula | C5H11NO4S2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CNS(=O)(=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H11NO4S2/c1-6-12(9,10)5-2-3-11(7,8)4-5/h5-6H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | FTGXBHVAKXUVFB-RXMQYKEDSA-N |
| XLogP | -1.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide (CID 7102181) is (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide is CNS(=O)(=O)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is FTGXBHVAKXUVFB-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H11NO4S2/c1-6-12(9,10)5-2-3-11(7,8)4-5/h5-6H,2-4H2,1H3/t5-/m1/s1.
What are the key properties of (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide?
(3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 213.28 g/mol, XLogP of -1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-methyl-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 7102181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).